C24H22N2O4 — CID 42147812
[(3S)-1-(1-oxidopyridin-1-ium-3-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone (PubChem CID 42147812) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is [(3S)-1-(1-oxidopyridin-1-ium-3-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone.
| Compound Name | [(3S)-1-(1-oxidopyridin-1-ium-3-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 42147812 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [(3S)-1-(1-oxidopyridin-1-ium-3-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)[C@H]1CCCN(C(=O)c2ccc[n+]([O-])c2)C1 |
| InChI | InChI=1S/C24H22N2O4/c27-23(18-10-12-22(13-11-18)30-21-8-2-1-3-9-21)19-6-4-14-25(16-19)24(28)20-7-5-15-26(29)17-20/h1-3,5,7-13,15,17,19H,4,6,14,16H2/t19-/m0/s1 |
| InChIKey | RSUYJWRZMZUAIB-IBGZPJMESA-N |
| XLogP | 3.85 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|