About [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone
[1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone (PubChem CID 45243380) has the molecular formula C26H23N3O3
and a molecular weight of 425.49 g/mol. Its IUPAC name is [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone.
Molecular Properties
| Compound Name | [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone |
| PubChem CID | 45243380 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)C1CCCN(C(=O)c2cn3ccccc3n2)C1 |
| InChI | InChI=1S/C26H23N3O3/c30-25(19-11-13-22(14-12-19)32-21-8-2-1-3-9-21)20-7-6-16-29(17-20)26(31)23-18-28-15-5-4-10-24(28)27-23/h1-5,8-15,18,20H,6-7,16-17H2 |
| InChIKey | LTCNULFQTGUSMH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone?
The IUPAC name of [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone (CID 45243380) is [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone.
What is the SMILES notation for [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone?
The canonical SMILES for [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone is O=C(c1ccc(Oc2ccccc2)cc1)C1CCCN(C(=O)c2cn3ccccc3n2)C1.
What is the InChIKey of [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone?
The InChIKey is LTCNULFQTGUSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3O3/c30-25(19-11-13-22(14-12-19)32-21-8-2-1-3-9-21)20-7-6-16-29(17-20)26(31)23-18-28-15-5-4-10-24(28)27-23/h1-5,8-15,18,20H,6-7,16-17H2.
What are the key properties of [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone?
[1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone has a molecular weight of 425.49 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(imidazo[1,2-a]pyridine-2-carbonyl)piperidin-3-yl]-(4-phenoxyphenyl)methanone is sourced from PubChem (CID 45243380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).