C18H17N3O — CID 46981584
imidazo[1,2-a]pyridin-2-yl-(3-phenylpyrrolidin-1-yl)methanone (PubChem CID 46981584) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-yl-(3-phenylpyrrolidin-1-yl)methanone.
| Compound Name | imidazo[1,2-a]pyridin-2-yl-(3-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 46981584 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-yl-(3-phenylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cn2ccccc2n1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H17N3O/c22-18(16-13-20-10-5-4-8-17(20)19-16)21-11-9-15(12-21)14-6-2-1-3-7-14/h1-8,10,13,15H,9,11-12H2 |
| InChIKey | ZQAMEBDPOCVVSS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |