C24H21FN2O3 — CID 42241584
(3-fluoro-4-phenylphenyl)-[(3R)-1-(1-oxidopyridin-1-ium-3-carbonyl)piperidin-3-yl]methanone (PubChem CID 42241584) has the molecular formula C24H21FN2O3 and a molecular weight of 404.44 g/mol. Its IUPAC name is (3-fluoro-4-phenylphenyl)-[(3R)-1-(1-oxidopyridin-1-ium-3-carbonyl)piperidin-3-yl]methanone.
| Compound Name | (3-fluoro-4-phenylphenyl)-[(3R)-1-(1-oxidopyridin-1-ium-3-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 42241584 |
| Molecular Formula | C24H21FN2O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (3-fluoro-4-phenylphenyl)-[(3R)-1-(1-oxidopyridin-1-ium-3-carbonyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)c(F)c1)[C@@H]1CCCN(C(=O)c2ccc[n+]([O-])c2)C1 |
| InChI | InChI=1S/C24H21FN2O3/c25-22-14-18(10-11-21(22)17-6-2-1-3-7-17)23(28)19-8-4-12-26(15-19)24(29)20-9-5-13-27(30)16-20/h1-3,5-7,9-11,13-14,16,19H,4,8,12,15H2/t19-/m1/s1 |
| InChIKey | TUHITRLASYPNNK-LJQANCHMSA-N |
| XLogP | 3.86 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|