C25H22FNO3S — CID 45206143
1-[4-[3-(3-fluoro-4-phenylbenzoyl)piperidine-1-carbonyl]thiophen-2-yl]ethanone (PubChem CID 45206143) has the molecular formula C25H22FNO3S and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-[4-[3-(3-fluoro-4-phenylbenzoyl)piperidine-1-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[3-(3-fluoro-4-phenylbenzoyl)piperidine-1-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 45206143 |
| Molecular Formula | C25H22FNO3S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1-[4-[3-(3-fluoro-4-phenylbenzoyl)piperidine-1-carbonyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(C(=O)N2CCCC(C(=O)c3ccc(-c4ccccc4)c(F)c3)C2)cs1 |
| InChI | InChI=1S/C25H22FNO3S/c1-16(28)23-13-20(15-31-23)25(30)27-11-5-8-19(14-27)24(29)18-9-10-21(22(26)12-18)17-6-3-2-4-7-17/h2-4,6-7,9-10,12-13,15,19H,5,8,11,14H2,1H3 |
| InChIKey | ZWHARZDDNQWCCM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |