C27H27FN2O2 — CID 45241693
N-(2,6-dimethylphenyl)-3-(3-fluoro-4-phenylbenzoyl)piperidine-1-carboxamide (PubChem CID 45241693) has the molecular formula C27H27FN2O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3-(3-fluoro-4-phenylbenzoyl)piperidine-1-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-3-(3-fluoro-4-phenylbenzoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 45241693 |
| Molecular Formula | C27H27FN2O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3-(3-fluoro-4-phenylbenzoyl)piperidine-1-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)N1CCCC(C(=O)c2ccc(-c3ccccc3)c(F)c2)C1 |
| InChI | InChI=1S/C27H27FN2O2/c1-18-8-6-9-19(2)25(18)29-27(32)30-15-7-12-22(17-30)26(31)21-13-14-23(24(28)16-21)20-10-4-3-5-11-20/h3-6,8-11,13-14,16,22H,7,12,15,17H2,1-2H3,(H,29,32) |
| InChIKey | YCZOTNUNNHVDSZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |