C23H24FN3O — CID 45252549
(3-fluoro-4-phenylphenyl)-[1-[(5-methyl-1H-pyrazol-3-yl)methyl]piperidin-3-yl]methanone (PubChem CID 45252549) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is (3-fluoro-4-phenylphenyl)-[1-[(5-methyl-1H-pyrazol-3-yl)methyl]piperidin-3-yl]methanone.
| Compound Name | (3-fluoro-4-phenylphenyl)-[1-[(5-methyl-1H-pyrazol-3-yl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45252549 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (3-fluoro-4-phenylphenyl)-[1-[(5-methyl-1H-pyrazol-3-yl)methyl]piperidin-3-yl]methanone |
| SMILES | Cc1cc(CN2CCCC(C(=O)c3ccc(-c4ccccc4)c(F)c3)C2)n[nH]1 |
| InChI | InChI=1S/C23H24FN3O/c1-16-12-20(26-25-16)15-27-11-5-8-19(14-27)23(28)18-9-10-21(22(24)13-18)17-6-3-2-4-7-17/h2-4,6-7,9-10,12-13,19H,5,8,11,14-15H2,1H3,(H,25,26) |
| InChIKey | JXHFTMLODFSDGA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |