C24H26FN3O — CID 42403988
(3-fluoro-4-phenylphenyl)-[(3S)-1-(3-pyrazol-1-ylpropyl)piperidin-3-yl]methanone (PubChem CID 42403988) has the molecular formula C24H26FN3O and a molecular weight of 391.49 g/mol. Its IUPAC name is (3-fluoro-4-phenylphenyl)-[(3S)-1-(3-pyrazol-1-ylpropyl)piperidin-3-yl]methanone.
| Compound Name | (3-fluoro-4-phenylphenyl)-[(3S)-1-(3-pyrazol-1-ylpropyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 42403988 |
| Molecular Formula | C24H26FN3O |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (3-fluoro-4-phenylphenyl)-[(3S)-1-(3-pyrazol-1-ylpropyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)c(F)c1)[C@H]1CCCN(CCCn2cccn2)C1 |
| InChI | InChI=1S/C24H26FN3O/c25-23-17-20(10-11-22(23)19-7-2-1-3-8-19)24(29)21-9-4-13-27(18-21)14-6-16-28-15-5-12-26-28/h1-3,5,7-8,10-12,15,17,21H,4,6,9,13-14,16,18H2/t21-/m0/s1 |
| InChIKey | MTIXMOUMWMVFBQ-NRFANRHFSA-N |
| XLogP | 4.67 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |