C24H27N3O — CID 95130724
(4-phenylphenyl)-[(3R)-1-(3-pyrazol-1-ylpropyl)piperidin-3-yl]methanone (PubChem CID 95130724) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is (4-phenylphenyl)-[(3R)-1-(3-pyrazol-1-ylpropyl)piperidin-3-yl]methanone.
| Compound Name | (4-phenylphenyl)-[(3R)-1-(3-pyrazol-1-ylpropyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 95130724 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (4-phenylphenyl)-[(3R)-1-(3-pyrazol-1-ylpropyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)[C@@H]1CCCN(CCCn2cccn2)C1 |
| InChI | InChI=1S/C24H27N3O/c28-24(22-12-10-21(11-13-22)20-7-2-1-3-8-20)23-9-4-15-26(19-23)16-6-18-27-17-5-14-25-27/h1-3,5,7-8,10-14,17,23H,4,6,9,15-16,18-19H2/t23-/m1/s1 |
| InChIKey | IAPNAFNFFUNLLR-HSZRJFAPSA-N |
| XLogP | 4.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |