C18H20N2O — CID 142430235
(1-benzylpiperidin-3-yl)-pyridin-4-ylmethanone (PubChem CID 142430235) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (1-benzylpiperidin-3-yl)-pyridin-4-ylmethanone.
| Compound Name | (1-benzylpiperidin-3-yl)-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 142430235 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (1-benzylpiperidin-3-yl)-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H20N2O/c21-18(16-8-10-19-11-9-16)17-7-4-12-20(14-17)13-15-5-2-1-3-6-15/h1-3,5-6,8-11,17H,4,7,12-14H2 |
| InChIKey | HFQMNUFWOZYARV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |