C22H27N3O — CID 98763268
[(3S)-1-benzylpiperidin-3-yl]-[(2S)-2-pyridin-4-ylpyrrolidin-1-yl]methanone (PubChem CID 98763268) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is [(3S)-1-benzylpiperidin-3-yl]-[(2S)-2-pyridin-4-ylpyrrolidin-1-yl]methanone.
| Compound Name | [(3S)-1-benzylpiperidin-3-yl]-[(2S)-2-pyridin-4-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 98763268 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | [(3S)-1-benzylpiperidin-3-yl]-[(2S)-2-pyridin-4-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C([C@H]1CCCN(Cc2ccccc2)C1)N1CCC[C@H]1c1ccncc1 |
| InChI | InChI=1S/C22H27N3O/c26-22(25-15-5-9-21(25)19-10-12-23-13-11-19)20-8-4-14-24(17-20)16-18-6-2-1-3-7-18/h1-3,6-7,10-13,20-21H,4-5,8-9,14-17H2/t20-,21-/m0/s1 |
| InChIKey | YLLVFNMVCPYWCN-SFTDATJTSA-N |
| XLogP | 3.66 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |