C24H24N2O — CID 45178461
(4-phenylphenyl)-[1-(pyridin-3-ylmethyl)piperidin-3-yl]methanone (PubChem CID 45178461) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is (4-phenylphenyl)-[1-(pyridin-3-ylmethyl)piperidin-3-yl]methanone.
| Compound Name | (4-phenylphenyl)-[1-(pyridin-3-ylmethyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45178461 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (4-phenylphenyl)-[1-(pyridin-3-ylmethyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)C1CCCN(Cc2cccnc2)C1 |
| InChI | InChI=1S/C24H24N2O/c27-24(22-12-10-21(11-13-22)20-7-2-1-3-8-20)23-9-5-15-26(18-23)17-19-6-4-14-25-16-19/h1-4,6-8,10-14,16,23H,5,9,15,17-18H2 |
| InChIKey | FHLGMVCRCMXFMI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |