C18H24N4O — CID 124757098
[(3S)-1-[3-(4-methylpyrazol-1-yl)propyl]piperidin-3-yl]-pyridin-2-ylmethanone (PubChem CID 124757098) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is [(3S)-1-[3-(4-methylpyrazol-1-yl)propyl]piperidin-3-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3S)-1-[3-(4-methylpyrazol-1-yl)propyl]piperidin-3-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 124757098 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [(3S)-1-[3-(4-methylpyrazol-1-yl)propyl]piperidin-3-yl]-pyridin-2-ylmethanone |
| SMILES | Cc1cnn(CCCN2CCC[C@H](C(=O)c3ccccn3)C2)c1 |
| InChI | InChI=1S/C18H24N4O/c1-15-12-20-22(13-15)11-5-10-21-9-4-6-16(14-21)18(23)17-7-2-3-8-19-17/h2-3,7-8,12-13,16H,4-6,9-11,14H2,1H3/t16-/m0/s1 |
| InChIKey | VNUPUXCAJIDMQX-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |