C22H24N4O — CID 99929635
[(3S)-1-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-3-yl]-pyridin-2-ylmethanone (PubChem CID 99929635) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is [(3S)-1-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-3-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3S)-1-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-3-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 99929635 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [(3S)-1-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-3-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@H]1CCCN(Cc2ccc(Cn3cccn3)cc2)C1 |
| InChI | InChI=1S/C22H24N4O/c27-22(21-6-1-2-11-23-21)20-5-3-13-25(17-20)15-18-7-9-19(10-8-18)16-26-14-4-12-24-26/h1-2,4,6-12,14,20H,3,5,13,15-17H2/t20-/m0/s1 |
| InChIKey | YOCGXXVXRQIVMS-FQEVSTJZSA-N |
| XLogP | 3.42 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |