C18H22N2O2 — CID 124753964
[(3S)-1-[3-(furan-2-yl)propyl]piperidin-3-yl]-pyridin-2-ylmethanone (PubChem CID 124753964) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is [(3S)-1-[3-(furan-2-yl)propyl]piperidin-3-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3S)-1-[3-(furan-2-yl)propyl]piperidin-3-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 124753964 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(3S)-1-[3-(furan-2-yl)propyl]piperidin-3-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@H]1CCCN(CCCc2ccco2)C1 |
| InChI | InChI=1S/C18H22N2O2/c21-18(17-9-1-2-10-19-17)15-6-3-11-20(14-15)12-4-7-16-8-5-13-22-16/h1-2,5,8-10,13,15H,3-4,6-7,11-12,14H2/t15-/m0/s1 |
| InChIKey | MYODXEKYWBRGQD-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |