C19H19NO4S — CID 97197017
4-[(3R)-1-(5-acetylthiophene-3-carbonyl)piperidin-3-yl]benzoic acid (PubChem CID 97197017) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-[(3R)-1-(5-acetylthiophene-3-carbonyl)piperidin-3-yl]benzoic acid.
| Compound Name | 4-[(3R)-1-(5-acetylthiophene-3-carbonyl)piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 97197017 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-[(3R)-1-(5-acetylthiophene-3-carbonyl)piperidin-3-yl]benzoic acid |
| SMILES | CC(=O)c1cc(C(=O)N2CCC[C@H](c3ccc(C(=O)O)cc3)C2)cs1 |
| InChI | InChI=1S/C19H19NO4S/c1-12(21)17-9-16(11-25-17)18(22)20-8-2-3-15(10-20)13-4-6-14(7-5-13)19(23)24/h4-7,9,11,15H,2-3,8,10H2,1H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | JFNPPERKYSBOCZ-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |