C21H20N2O3S — CID 72841928
4-[1-(2-methyl-1,3-benzothiazole-5-carbonyl)piperidin-3-yl]benzoic acid (PubChem CID 72841928) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-[1-(2-methyl-1,3-benzothiazole-5-carbonyl)piperidin-3-yl]benzoic acid.
| Compound Name | 4-[1-(2-methyl-1,3-benzothiazole-5-carbonyl)piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72841928 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-[1-(2-methyl-1,3-benzothiazole-5-carbonyl)piperidin-3-yl]benzoic acid |
| SMILES | Cc1nc2cc(C(=O)N3CCCC(c4ccc(C(=O)O)cc4)C3)ccc2s1 |
| InChI | InChI=1S/C21H20N2O3S/c1-13-22-18-11-16(8-9-19(18)27-13)20(24)23-10-2-3-17(12-23)14-4-6-15(7-5-14)21(25)26/h4-9,11,17H,2-3,10,12H2,1H3,(H,25,26) |
| InChIKey | CJYUHEVCOBDUEI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |