C19H21N3O3 — CID 72878672
4-[1-(2,6-dimethylpyrimidine-4-carbonyl)piperidin-3-yl]benzoic acid (PubChem CID 72878672) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[1-(2,6-dimethylpyrimidine-4-carbonyl)piperidin-3-yl]benzoic acid.
| Compound Name | 4-[1-(2,6-dimethylpyrimidine-4-carbonyl)piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72878672 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-[1-(2,6-dimethylpyrimidine-4-carbonyl)piperidin-3-yl]benzoic acid |
| SMILES | Cc1cc(C(=O)N2CCCC(c3ccc(C(=O)O)cc3)C2)nc(C)n1 |
| InChI | InChI=1S/C19H21N3O3/c1-12-10-17(21-13(2)20-12)18(23)22-9-3-4-16(11-22)14-5-7-15(8-6-14)19(24)25/h5-8,10,16H,3-4,9,11H2,1-2H3,(H,24,25) |
| InChIKey | GGJCVZALAYRZTR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |