C14H19NO2S2 — CID 97444747
1-[4-[(3S)-3-(methylsulfanylmethyl)piperidine-1-carbonyl]thiophen-2-yl]ethanone (PubChem CID 97444747) has the molecular formula C14H19NO2S2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-[4-[(3S)-3-(methylsulfanylmethyl)piperidine-1-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[(3S)-3-(methylsulfanylmethyl)piperidine-1-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 97444747 |
| Molecular Formula | C14H19NO2S2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-[4-[(3S)-3-(methylsulfanylmethyl)piperidine-1-carbonyl]thiophen-2-yl]ethanone |
| SMILES | CSC[C@H]1CCCN(C(=O)c2csc(C(C)=O)c2)C1 |
| InChI | InChI=1S/C14H19NO2S2/c1-10(16)13-6-12(9-19-13)14(17)15-5-3-4-11(7-15)8-18-2/h6,9,11H,3-5,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | WEPKDNOVWWLXCG-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |