C11H17N3OS — CID 125144378
1H-imidazol-5-yl-[(3S)-3-(methylsulfanylmethyl)piperidin-1-yl]methanone (PubChem CID 125144378) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 1H-imidazol-5-yl-[(3S)-3-(methylsulfanylmethyl)piperidin-1-yl]methanone.
| Compound Name | 1H-imidazol-5-yl-[(3S)-3-(methylsulfanylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 125144378 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1H-imidazol-5-yl-[(3S)-3-(methylsulfanylmethyl)piperidin-1-yl]methanone |
| SMILES | CSC[C@H]1CCCN(C(=O)c2cnc[nH]2)C1 |
| InChI | InChI=1S/C11H17N3OS/c1-16-7-9-3-2-4-14(6-9)11(15)10-5-12-8-13-10/h5,8-9H,2-4,6-7H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | ZQTRYZNMVKTWBL-VIFPVBQESA-N |
| XLogP | 1.62 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |