C12H17NO2S2 — CID 107037197
[3-(methoxymethyl)piperidin-1-yl]-(4-sulfanylthiophen-2-yl)methanone (PubChem CID 107037197) has the molecular formula C12H17NO2S2 and a molecular weight of 271.41 g/mol. Its IUPAC name is [3-(methoxymethyl)piperidin-1-yl]-(4-sulfanylthiophen-2-yl)methanone.
| Compound Name | [3-(methoxymethyl)piperidin-1-yl]-(4-sulfanylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 107037197 |
| Molecular Formula | C12H17NO2S2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | [3-(methoxymethyl)piperidin-1-yl]-(4-sulfanylthiophen-2-yl)methanone |
| SMILES | COCC1CCCN(C(=O)c2cc(S)cs2)C1 |
| InChI | InChI=1S/C12H17NO2S2/c1-15-7-9-3-2-4-13(6-9)12(14)11-5-10(16)8-17-11/h5,8-9,16H,2-4,6-7H2,1H3 |
| InChIKey | FTTFHABWQOOUOG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|