C12H19N3O4S2 — CID 79461060
1-(4-methoxythiophene-2-carbonyl)-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 79461060) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-(4-methoxythiophene-2-carbonyl)-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-(4-methoxythiophene-2-carbonyl)-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 79461060 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-(4-methoxythiophene-2-carbonyl)-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | COc1csc(C(=O)N2CCCC(CNS(N)(=O)=O)C2)c1 |
| InChI | InChI=1S/C12H19N3O4S2/c1-19-10-5-11(20-8-10)12(16)15-4-2-3-9(7-15)6-14-21(13,17)18/h5,8-9,14H,2-4,6-7H2,1H3,(H2,13,17,18) |
| InChIKey | LOMFYPJKBBHPQI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |