C13H19N3O4S — CID 61132158
phenyl 3-[(sulfamoylamino)methyl]piperidine-1-carboxylate (PubChem CID 61132158) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is phenyl 3-[(sulfamoylamino)methyl]piperidine-1-carboxylate.
| Compound Name | phenyl 3-[(sulfamoylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 61132158 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | phenyl 3-[(sulfamoylamino)methyl]piperidine-1-carboxylate |
| SMILES | NS(=O)(=O)NCC1CCCN(C(=O)Oc2ccccc2)C1 |
| InChI | InChI=1S/C13H19N3O4S/c14-21(18,19)15-9-11-5-4-8-16(10-11)13(17)20-12-6-2-1-3-7-12/h1-3,6-7,11,15H,4-5,8-10H2,(H2,14,18,19) |
| InChIKey | NBEKMIIHKOBSAP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |