C11H17N5O4S — CID 61130865
2-oxo-5-[3-[(sulfamoylamino)methyl]piperidine-1-carbonyl]-1H-pyrazine (PubChem CID 61130865) has the molecular formula C11H17N5O4S and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-oxo-5-[3-[(sulfamoylamino)methyl]piperidine-1-carbonyl]-1H-pyrazine.
| Compound Name | 2-oxo-5-[3-[(sulfamoylamino)methyl]piperidine-1-carbonyl]-1H-pyrazine |
|---|---|
| PubChem CID | 61130865 |
| Molecular Formula | C11H17N5O4S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-oxo-5-[3-[(sulfamoylamino)methyl]piperidine-1-carbonyl]-1H-pyrazine |
| SMILES | NS(=O)(=O)NCC1CCCN(C(=O)c2c[nH]c(=O)cn2)C1 |
| InChI | InChI=1S/C11H17N5O4S/c12-21(19,20)15-4-8-2-1-3-16(7-8)11(18)9-5-14-10(17)6-13-9/h5-6,8,15H,1-4,7H2,(H,14,17)(H2,12,19,20) |
| InChIKey | ZHOBVOLRMIKMLD-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |