C11H15Br2N3O3S2 — CID 80534447
1-(4,5-dibromothiophene-2-carbonyl)-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 80534447) has the molecular formula C11H15Br2N3O3S2 and a molecular weight of 461.20 g/mol. Its IUPAC name is 1-(4,5-dibromothiophene-2-carbonyl)-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-(4,5-dibromothiophene-2-carbonyl)-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 80534447 |
| Molecular Formula | C11H15Br2N3O3S2 |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 458.89 |
| IUPAC Name | 1-(4,5-dibromothiophene-2-carbonyl)-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | NS(=O)(=O)NCC1CCCN(C(=O)c2cc(Br)c(Br)s2)C1 |
| InChI | InChI=1S/C11H15Br2N3O3S2/c12-8-4-9(20-10(8)13)11(17)16-3-1-2-7(6-16)5-15-21(14,18)19/h4,7,15H,1-3,5-6H2,(H2,14,18,19) |
| InChIKey | AQNYFNBMAUILBZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |