C10H20ClN3O3S — CID 62727034
1-(3-chloro-2-methylpropanoyl)-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 62727034) has the molecular formula C10H20ClN3O3S and a molecular weight of 297.81 g/mol. Its IUPAC name is 1-(3-chloro-2-methylpropanoyl)-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-(3-chloro-2-methylpropanoyl)-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 62727034 |
| Molecular Formula | C10H20ClN3O3S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-(3-chloro-2-methylpropanoyl)-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | CC(CCl)C(=O)N1CCCC(CNS(N)(=O)=O)C1 |
| InChI | InChI=1S/C10H20ClN3O3S/c1-8(5-11)10(15)14-4-2-3-9(7-14)6-13-18(12,16)17/h8-9,13H,2-7H2,1H3,(H2,12,16,17) |
| InChIKey | ABGFPNXKEZSMLW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|