C11H24N4O3S — CID 54873297
1-[4-(methylamino)butanoyl]-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 54873297) has the molecular formula C11H24N4O3S and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-[4-(methylamino)butanoyl]-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-[4-(methylamino)butanoyl]-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 54873297 |
| Molecular Formula | C11H24N4O3S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-[4-(methylamino)butanoyl]-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | CNCCCC(=O)N1CCCC(CNS(N)(=O)=O)C1 |
| InChI | InChI=1S/C11H24N4O3S/c1-13-6-2-5-11(16)15-7-3-4-10(9-15)8-14-19(12,17)18/h10,13-14H,2-9H2,1H3,(H2,12,17,18) |
| InChIKey | AKALMLBBHSQQHR-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|