C10H17N3O3S — CID 107992574
1-but-2-ynoyl-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 107992574) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-but-2-ynoyl-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-but-2-ynoyl-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 107992574 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-but-2-ynoyl-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | CC#CC(=O)N1CCCC(CNS(N)(=O)=O)C1 |
| InChI | InChI=1S/C10H17N3O3S/c1-2-4-10(14)13-6-3-5-9(8-13)7-12-17(11,15)16/h9,12H,3,5-8H2,1H3,(H2,11,15,16) |
| InChIKey | XVRLBTRHRXPVAF-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|