C10H21N5O4S — CID 60963858
2-amino-N-[2-oxo-2-[3-[(sulfamoylamino)methyl]piperidin-1-yl]ethyl]acetamide (PubChem CID 60963858) has the molecular formula C10H21N5O4S and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-[3-[(sulfamoylamino)methyl]piperidin-1-yl]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-[3-[(sulfamoylamino)methyl]piperidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 60963858 |
| Molecular Formula | C10H21N5O4S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-amino-N-[2-oxo-2-[3-[(sulfamoylamino)methyl]piperidin-1-yl]ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)N1CCCC(CNS(N)(=O)=O)C1 |
| InChI | InChI=1S/C10H21N5O4S/c11-4-9(16)13-6-10(17)15-3-1-2-8(7-15)5-14-20(12,18)19/h8,14H,1-7,11H2,(H,13,16)(H2,12,18,19) |
| InChIKey | TWYXZRHVNLRSNW-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |