C15H24ClN3O3S — CID 119288841
N-[[1-(2-amino-2-phenylacetyl)piperidin-3-yl]methyl]methanesulfonamide;hydrochloride (PubChem CID 119288841) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is N-[[1-(2-amino-2-phenylacetyl)piperidin-3-yl]methyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[[1-(2-amino-2-phenylacetyl)piperidin-3-yl]methyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119288841 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[[1-(2-amino-2-phenylacetyl)piperidin-3-yl]methyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)NCC1CCCN(C(=O)C(N)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C15H23N3O3S.ClH/c1-22(20,21)17-10-12-6-5-9-18(11-12)15(19)14(16)13-7-3-2-4-8-13;/h2-4,7-8,12,14,17H,5-6,9-11,16H2,1H3;1H |
| InChIKey | XUOKHFDZVZYJBY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |