C11H22N4O4S — CID 60964076
3-amino-4-[3-(methanesulfonamidomethyl)piperidin-1-yl]-4-oxobutanamide (PubChem CID 60964076) has the molecular formula C11H22N4O4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-amino-4-[3-(methanesulfonamidomethyl)piperidin-1-yl]-4-oxobutanamide.
| Compound Name | 3-amino-4-[3-(methanesulfonamidomethyl)piperidin-1-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 60964076 |
| Molecular Formula | C11H22N4O4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-amino-4-[3-(methanesulfonamidomethyl)piperidin-1-yl]-4-oxobutanamide |
| SMILES | CS(=O)(=O)NCC1CCCN(C(=O)C(N)CC(N)=O)C1 |
| InChI | InChI=1S/C11H22N4O4S/c1-20(18,19)14-6-8-3-2-4-15(7-8)11(17)9(12)5-10(13)16/h8-9,14H,2-7,12H2,1H3,(H2,13,16) |
| InChIKey | ABMGQZPGZNYKGA-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |