C11H22N2O4S — CID 60776412
N-[[1-(2-ethoxyacetyl)piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 60776412) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is N-[[1-(2-ethoxyacetyl)piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(2-ethoxyacetyl)piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 60776412 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[[1-(2-ethoxyacetyl)piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | CCOCC(=O)N1CCCC(CNS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H22N2O4S/c1-3-17-9-11(14)13-6-4-5-10(8-13)7-12-18(2,15)16/h10,12H,3-9H2,1-2H3 |
| InChIKey | RUERBCQMUKNTNX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |