C12H22N2O3S — CID 136514848
N-[[1-(1-methylcyclopropanecarbonyl)piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 136514848) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[[1-(1-methylcyclopropanecarbonyl)piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(1-methylcyclopropanecarbonyl)piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 136514848 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-[[1-(1-methylcyclopropanecarbonyl)piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | CC1(C(=O)N2CCCC(CNS(C)(=O)=O)C2)CC1 |
| InChI | InChI=1S/C12H22N2O3S/c1-12(5-6-12)11(15)14-7-3-4-10(9-14)8-13-18(2,16)17/h10,13H,3-9H2,1-2H3 |
| InChIKey | FXBCGIYTUIQKCR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |