C15H22N2O2 — CID 103796537
(2R)-2-amino-1-[3-(methoxymethyl)piperidin-1-yl]-2-phenylethanone (PubChem CID 103796537) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2R)-2-amino-1-[3-(methoxymethyl)piperidin-1-yl]-2-phenylethanone.
| Compound Name | (2R)-2-amino-1-[3-(methoxymethyl)piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 103796537 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2R)-2-amino-1-[3-(methoxymethyl)piperidin-1-yl]-2-phenylethanone |
| SMILES | COCC1CCCN(C(=O)[C@H](N)c2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2O2/c1-19-11-12-6-5-9-17(10-12)15(18)14(16)13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11,16H2,1H3/t12?,14-/m1/s1 |
| InChIKey | PGVIFUXJLMLGKD-TYZXPVIJSA-N |
| XLogP | 1.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |