C9H12N2OS2 — CID 107027846
(3-aminopyrrolidin-1-yl)-(4-sulfanylthiophen-2-yl)methanone (PubChem CID 107027846) has the molecular formula C9H12N2OS2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(4-sulfanylthiophen-2-yl)methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-(4-sulfanylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 107027846 |
| Molecular Formula | C9H12N2OS2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(4-sulfanylthiophen-2-yl)methanone |
| SMILES | NC1CCN(C(=O)c2cc(S)cs2)C1 |
| InChI | InChI=1S/C9H12N2OS2/c10-6-1-2-11(4-6)9(12)8-3-7(13)5-14-8/h3,5-6,13H,1-2,4,10H2 |
| InChIKey | UPONIDUGJOEHQZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|