C9H12BrClN2OS — CID 119483030
(3-aminopyrrolidin-1-yl)-(5-bromothiophen-3-yl)methanone;hydrochloride (PubChem CID 119483030) has the molecular formula C9H12BrClN2OS and a molecular weight of 311.63 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(5-bromothiophen-3-yl)methanone;hydrochloride.
| Compound Name | (3-aminopyrrolidin-1-yl)-(5-bromothiophen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119483030 |
| Molecular Formula | C9H12BrClN2OS |
| Molecular Weight | 311.63 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(5-bromothiophen-3-yl)methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2csc(Br)c2)C1 |
| InChI | InChI=1S/C9H11BrN2OS.ClH/c10-8-3-6(5-14-8)9(13)12-2-1-7(11)4-12;/h3,5,7H,1-2,4,11H2;1H |
| InChIKey | HKACUZFUPAKGRL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |