C9H13BrClN3O — CID 131101757
[(3R)-3-aminopyrrolidin-1-yl]-(5-bromo-1H-pyrrol-3-yl)methanone;hydrochloride (PubChem CID 131101757) has the molecular formula C9H13BrClN3O and a molecular weight of 294.58 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(5-bromo-1H-pyrrol-3-yl)methanone;hydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(5-bromo-1H-pyrrol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 131101757 |
| Molecular Formula | C9H13BrClN3O |
| Molecular Weight | 294.58 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(5-bromo-1H-pyrrol-3-yl)methanone;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)c2c[nH]c(Br)c2)C1 |
| InChI | InChI=1S/C9H12BrN3O.ClH/c10-8-3-6(4-12-8)9(14)13-2-1-7(11)5-13;/h3-4,7,12H,1-2,5,11H2;1H/t7-;/m1./s1 |
| InChIKey | WXIKPDVZGCNHEM-OGFXRTJISA-N |
| XLogP | 1.37 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |