C11H14N2O2 — CID 62067516
(3-aminopyrrolidin-1-yl)-(4-hydroxyphenyl)methanone (PubChem CID 62067516) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(4-hydroxyphenyl)methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 62067516 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(4-hydroxyphenyl)methanone |
| SMILES | NC1CCN(C(=O)c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C11H14N2O2/c12-9-5-6-13(7-9)11(15)8-1-3-10(14)4-2-8/h1-4,9,14H,5-7,12H2 |
| InChIKey | VAUMMKDLNLTOLL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |