C12H13F3N2O3S — CID 124574517
[(3S)-3-aminopyrrolidin-1-yl]-[4-(trifluoromethylsulfonyl)phenyl]methanone (PubChem CID 124574517) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is [(3S)-3-aminopyrrolidin-1-yl]-[4-(trifluoromethylsulfonyl)phenyl]methanone.
| Compound Name | [(3S)-3-aminopyrrolidin-1-yl]-[4-(trifluoromethylsulfonyl)phenyl]methanone |
|---|---|
| PubChem CID | 124574517 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | [(3S)-3-aminopyrrolidin-1-yl]-[4-(trifluoromethylsulfonyl)phenyl]methanone |
| SMILES | N[C@H]1CCN(C(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C12H13F3N2O3S/c13-12(14,15)21(19,20)10-3-1-8(2-4-10)11(18)17-6-5-9(16)7-17/h1-4,9H,5-7,16H2/t9-/m0/s1 |
| InChIKey | KGKYPMWCCPOPKC-VIFPVBQESA-N |
| XLogP | 1.15 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |