C19H23F3N2O4S — CID 55566577
2-cyclopentyl-1-[4-[4-(trifluoromethylsulfonyl)benzoyl]piperazin-1-yl]ethanone (PubChem CID 55566577) has the molecular formula C19H23F3N2O4S and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-cyclopentyl-1-[4-[4-(trifluoromethylsulfonyl)benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[4-[4-(trifluoromethylsulfonyl)benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55566577 |
| Molecular Formula | C19H23F3N2O4S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-cyclopentyl-1-[4-[4-(trifluoromethylsulfonyl)benzoyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CC1CCCC1)N1CCN(C(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H23F3N2O4S/c20-19(21,22)29(27,28)16-7-5-15(6-8-16)18(26)24-11-9-23(10-12-24)17(25)13-14-3-1-2-4-14/h5-8,14H,1-4,9-13H2 |
| InChIKey | UBKWNDLRMNMELH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |