C11H14N2O3 — CID 107705169
[(3R)-3-aminopyrrolidin-1-yl]-(3,5-dihydroxyphenyl)methanone (PubChem CID 107705169) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(3,5-dihydroxyphenyl)methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(3,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 107705169 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(3,5-dihydroxyphenyl)methanone |
| SMILES | N[C@@H]1CCN(C(=O)c2cc(O)cc(O)c2)C1 |
| InChI | InChI=1S/C11H14N2O3/c12-8-1-2-13(6-8)11(16)7-3-9(14)5-10(15)4-7/h3-5,8,14-15H,1-2,6,12H2/t8-/m1/s1 |
| InChIKey | UPXXFAIGSACKLU-MRVPVSSYSA-N |
| XLogP | 0.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |