C11H13BrClFN2O — CID 119934528
[(3S)-3-aminopyrrolidin-1-yl]-(3-bromo-4-fluorophenyl)methanone;hydrochloride (PubChem CID 119934528) has the molecular formula C11H13BrClFN2O and a molecular weight of 323.59 g/mol. Its IUPAC name is [(3S)-3-aminopyrrolidin-1-yl]-(3-bromo-4-fluorophenyl)methanone;hydrochloride.
| Compound Name | [(3S)-3-aminopyrrolidin-1-yl]-(3-bromo-4-fluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119934528 |
| Molecular Formula | C11H13BrClFN2O |
| Molecular Weight | 323.59 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | [(3S)-3-aminopyrrolidin-1-yl]-(3-bromo-4-fluorophenyl)methanone;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(C(=O)c2ccc(F)c(Br)c2)C1 |
| InChI | InChI=1S/C11H12BrFN2O.ClH/c12-9-5-7(1-2-10(9)13)11(16)15-4-3-8(14)6-15;/h1-2,5,8H,3-4,6,14H2;1H/t8-;/m0./s1 |
| InChIKey | VZXYVCQKYZEKED-QRPNPIFTSA-N |
| XLogP | 2.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |