C12H15BrClFN2O — CID 119376292
(4-aminopiperidin-1-yl)-(3-bromo-4-fluorophenyl)methanone;hydrochloride (PubChem CID 119376292) has the molecular formula C12H15BrClFN2O and a molecular weight of 337.62 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-(3-bromo-4-fluorophenyl)methanone;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-(3-bromo-4-fluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119376292 |
| Molecular Formula | C12H15BrClFN2O |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (4-aminopiperidin-1-yl)-(3-bromo-4-fluorophenyl)methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C12H14BrFN2O.ClH/c13-10-7-8(1-2-11(10)14)12(17)16-5-3-9(15)4-6-16;/h1-2,7,9H,3-6,15H2;1H |
| InChIKey | FBXNBJNFLQKBEO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |