C15H21BrClFN2O — CID 119647709
(3-bromo-4-fluorophenyl)-[4-(ethylaminomethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119647709) has the molecular formula C15H21BrClFN2O and a molecular weight of 379.70 g/mol. Its IUPAC name is (3-bromo-4-fluorophenyl)-[4-(ethylaminomethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (3-bromo-4-fluorophenyl)-[4-(ethylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119647709 |
| Molecular Formula | C15H21BrClFN2O |
| Molecular Weight | 379.70 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (3-bromo-4-fluorophenyl)-[4-(ethylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)c2ccc(F)c(Br)c2)CC1.Cl |
| InChI | InChI=1S/C15H20BrFN2O.ClH/c1-2-18-10-11-5-7-19(8-6-11)15(20)12-3-4-14(17)13(16)9-12;/h3-4,9,11,18H,2,5-8,10H2,1H3;1H |
| InChIKey | SIYGNIFLBDBTPF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |