C11H15NOS2 — CID 107032413
(3,3-dimethylpyrrolidin-1-yl)-(4-sulfanylthiophen-2-yl)methanone (PubChem CID 107032413) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is (3,3-dimethylpyrrolidin-1-yl)-(4-sulfanylthiophen-2-yl)methanone.
| Compound Name | (3,3-dimethylpyrrolidin-1-yl)-(4-sulfanylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 107032413 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (3,3-dimethylpyrrolidin-1-yl)-(4-sulfanylthiophen-2-yl)methanone |
| SMILES | CC1(C)CCN(C(=O)c2cc(S)cs2)C1 |
| InChI | InChI=1S/C11H15NOS2/c1-11(2)3-4-12(7-11)10(13)9-5-8(14)6-15-9/h5-6,14H,3-4,7H2,1-2H3 |
| InChIKey | QCNRDBYTPSROQE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|