C9H10N2O2S2 — CID 107021528
4-(4-sulfanylthiophene-2-carbonyl)piperazin-2-one (PubChem CID 107021528) has the molecular formula C9H10N2O2S2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-(4-sulfanylthiophene-2-carbonyl)piperazin-2-one.
| Compound Name | 4-(4-sulfanylthiophene-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 107021528 |
| Molecular Formula | C9H10N2O2S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 4-(4-sulfanylthiophene-2-carbonyl)piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2cc(S)cs2)CCN1 |
| InChI | InChI=1S/C9H10N2O2S2/c12-8-4-11(2-1-10-8)9(13)7-3-6(14)5-15-7/h3,5,14H,1-2,4H2,(H,10,12) |
| InChIKey | ZSYRBNWYOLZASA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|