cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid

C15H18O4 — CID 24722452

IUPACcis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid
SMILESCOc1cccc(C(=O)[C@H]2CCC[C@@H](C(=O)O)C2)c1
InChIInChI=1S/C15H18O4/c1-19-13-7-3-5-11(9-13)14(16)10-4-2-6-12(8-10)15(17)18/h3,5,7,9-10,12H,2,4,6,8H2,1H3,(H,17,18)/t10-,12+/m0/s1
InChIKeyWLLTZNKQSVRPKW-CMPLNLGQSA-N
MW262.31 g/mol
LogP2.77
Rot. Bonds4

About cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid

cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid (PubChem CID 24722452) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid
PubChem CID24722452
Molecular FormulaC15H18O4
Molecular Weight262.31 g/mol
Exact Mass262.12
IUPAC Namecis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid
SMILESCOc1cccc(C(=O)[C@H]2CCC[C@@H](C(=O)O)C2)c1
InChIInChI=1S/C15H18O4/c1-19-13-7-3-5-11(9-13)14(16)10-4-2-6-12(8-10)15(17)18/h3,5,7,9-10,12H,2,4,6,8H2,1H3,(H,17,18)/t10-,12+/m0/s1
InChIKeyWLLTZNKQSVRPKW-CMPLNLGQSA-N
XLogP2.77
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.31
LogP ≤ 52.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid (CID 24722452) is cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid is COc1cccc(C(=O)[C@H]2CCC[C@@H](C(=O)O)C2)c1.
What is the InChIKey of cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid?
The InChIKey is WLLTZNKQSVRPKW-CMPLNLGQSA-N. The full InChI is InChI=1S/C15H18O4/c1-19-13-7-3-5-11(9-13)14(16)10-4-2-6-12(8-10)15(17)18/h3,5,7,9-10,12H,2,4,6,8H2,1H3,(H,17,18)/t10-,12+/m0/s1.
What are the key properties of cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid?
cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid has a molecular weight of 262.31 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-3-(3-methoxybenzoyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 24722452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).