C15H21NO2 — CID 2852240
(2,6-dimethylpiperidin-1-yl)-(3-methoxyphenyl)methanone (PubChem CID 2852240) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-(3-methoxyphenyl)methanone.
| Compound Name | (2,6-dimethylpiperidin-1-yl)-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 2852240 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2C(C)CCCC2C)c1 |
| InChI | InChI=1S/C15H21NO2/c1-11-6-4-7-12(2)16(11)15(17)13-8-5-9-14(10-13)18-3/h5,8-12H,4,6-7H2,1-3H3 |
| InChIKey | PYABAWMPQQPHIA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |