C17H25NO3 — CID 95319434
[(2R,6R)-2,6-dimethylpiperidin-1-yl]-[3-(2-methoxyethoxy)phenyl]methanone (PubChem CID 95319434) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is [(2R,6R)-2,6-dimethylpiperidin-1-yl]-[3-(2-methoxyethoxy)phenyl]methanone.
| Compound Name | [(2R,6R)-2,6-dimethylpiperidin-1-yl]-[3-(2-methoxyethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 95319434 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [(2R,6R)-2,6-dimethylpiperidin-1-yl]-[3-(2-methoxyethoxy)phenyl]methanone |
| SMILES | COCCOc1cccc(C(=O)N2[C@H](C)CCC[C@H]2C)c1 |
| InChI | InChI=1S/C17H25NO3/c1-13-6-4-7-14(2)18(13)17(19)15-8-5-9-16(12-15)21-11-10-20-3/h5,8-9,12-14H,4,6-7,10-11H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | OSCAABDFMBRQPI-ZIAGYGMSSA-N |
| XLogP | 3.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|