C16H21NO4 — CID 16769713
3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoic acid (PubChem CID 16769713) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoic acid.
| Compound Name | 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 16769713 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoic acid |
| SMILES | CC1CCCC(C)N1C(=O)COc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H21NO4/c1-11-5-3-6-12(2)17(11)15(18)10-21-14-8-4-7-13(9-14)16(19)20/h4,7-9,11-12H,3,5-6,10H2,1-2H3,(H,19,20) |
| InChIKey | RJMQLOJCEIPTPZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |